C21H26FIN6O2 — CID 130350660
9-[3-[ethyl(propan-2-yl)amino]propyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine (PubChem CID 130350660) has the molecular formula C21H26FIN6O2 and a molecular weight of 540.38 g/mol. Its IUPAC name is 9-[3-[ethyl(propan-2-yl)amino]propyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[3-[ethyl(propan-2-yl)amino]propyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 130350660 |
| Molecular Formula | C21H26FIN6O2 |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 9-[3-[ethyl(propan-2-yl)amino]propyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
| SMILES | CCN(CCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21)C(C)C |
| InChI | InChI=1S/C21H26FIN6O2/c1-4-28(12(2)3)6-5-7-29-17(25-18-19(24)26-21(22)27-20(18)29)9-13-8-15-16(10-14(13)23)31-11-30-15/h8,10,12H,4-7,9,11H2,1-3H3,(H2,24,26,27) |
| InChIKey | MPYRAPDOPKIANJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|