C14H11FIN5O2 — CID 59708851
2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-methylpurin-6-amine (PubChem CID 59708851) has the molecular formula C14H11FIN5O2 and a molecular weight of 427.18 g/mol. Its IUPAC name is 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-methylpurin-6-amine.
| Compound Name | 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 59708851 |
| Molecular Formula | C14H11FIN5O2 |
| Molecular Weight | 427.18 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-methylpurin-6-amine |
| SMILES | Cn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C14H11FIN5O2/c1-21-10(18-11-12(17)19-14(15)20-13(11)21)3-6-2-8-9(4-7(6)16)23-5-22-8/h2,4H,3,5H2,1H3,(H2,17,19,20) |
| InChIKey | YHPZBDSHAAVENX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|