C18H18FIN6O4S — CID 90073087
N-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]cyclopropanesulfonamide (PubChem CID 90073087) has the molecular formula C18H18FIN6O4S and a molecular weight of 560.35 g/mol. Its IUPAC name is N-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]cyclopropanesulfonamide.
| Compound Name | N-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 90073087 |
| Molecular Formula | C18H18FIN6O4S |
| Molecular Weight | 560.35 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | N-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]cyclopropanesulfonamide |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CCNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C18H18FIN6O4S/c19-18-24-16(21)15-17(25-18)26(4-3-22-31(27,28)10-1-2-10)14(23-15)6-9-5-12-13(7-11(9)20)30-8-29-12/h5,7,10,22H,1-4,6,8H2,(H2,21,24,25) |
| InChIKey | XPNZUKJQPWOFNY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|