C19H20FIN6O3 — CID 90072979
3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-propan-2-ylpropanamide (PubChem CID 90072979) has the molecular formula C19H20FIN6O3 and a molecular weight of 526.31 g/mol. Its IUPAC name is 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-propan-2-ylpropanamide.
| Compound Name | 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 90072979 |
| Molecular Formula | C19H20FIN6O3 |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C19H20FIN6O3/c1-9(2)23-15(28)3-4-27-14(24-16-17(22)25-19(20)26-18(16)27)6-10-5-12-13(7-11(10)21)30-8-29-12/h5,7,9H,3-4,6,8H2,1-2H3,(H,23,28)(H2,22,25,26) |
| InChIKey | UVPFURULLUKACZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|