C22H28FIN6O3 — CID 59708860
4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]butan-1-ol (PubChem CID 59708860) has the molecular formula C22H28FIN6O3 and a molecular weight of 570.41 g/mol. Its IUPAC name is 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]butan-1-ol.
| Compound Name | 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]butan-1-ol |
|---|---|
| PubChem CID | 59708860 |
| Molecular Formula | C22H28FIN6O3 |
| Molecular Weight | 570.41 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]butan-1-ol |
| SMILES | CC(C)N(CCCCO)CCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C22H28FIN6O3/c1-13(2)29(5-3-4-8-31)6-7-30-18(26-19-20(25)27-22(23)28-21(19)30)10-14-9-16-17(11-15(14)24)33-12-32-16/h9,11,13,31H,3-8,10,12H2,1-2H3,(H2,25,27,28) |
| InChIKey | XTDSETCFJABYLS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|