C17H18FIN6O4S — CID 90072716
3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-methylpropane-1-sulfonamide (PubChem CID 90072716) has the molecular formula C17H18FIN6O4S and a molecular weight of 548.34 g/mol. Its IUPAC name is 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-methylpropane-1-sulfonamide.
| Compound Name | 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 90072716 |
| Molecular Formula | C17H18FIN6O4S |
| Molecular Weight | 548.34 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]-N-methylpropane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C17H18FIN6O4S/c1-21-30(26,27)4-2-3-25-13(22-14-15(20)23-17(18)24-16(14)25)6-9-5-11-12(7-10(9)19)29-8-28-11/h5,7,21H,2-4,6,8H2,1H3,(H2,20,23,24) |
| InChIKey | FTUNEIARRJTKPA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|