C16H16FIN6O2 — CID 86713738
9-(3-aminopropyl)-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine (PubChem CID 86713738) has the molecular formula C16H16FIN6O2 and a molecular weight of 470.25 g/mol. Its IUPAC name is 9-(3-aminopropyl)-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine.
| Compound Name | 9-(3-aminopropyl)-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 86713738 |
| Molecular Formula | C16H16FIN6O2 |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 9-(3-aminopropyl)-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
| SMILES | NCCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C16H16FIN6O2/c17-16-22-14(20)13-15(23-16)24(3-1-2-19)12(21-13)5-8-4-10-11(6-9(8)18)26-7-25-10/h4,6H,1-3,5,7,19H2,(H2,20,22,23) |
| InChIKey | AGUHPJCBIBUCNL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|