C18H18FIN6O4S2 — CID 66562784
N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropanesulfonamide (PubChem CID 66562784) has the molecular formula C18H18FIN6O4S2 and a molecular weight of 592.42 g/mol. Its IUPAC name is N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropanesulfonamide.
| Compound Name | N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 66562784 |
| Molecular Formula | C18H18FIN6O4S2 |
| Molecular Weight | 592.42 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]cyclopropanesulfonamide |
| SMILES | Nc1nc(F)nc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C18H18FIN6O4S2/c19-17-24-15(21)14-16(25-17)26(5-1-4-22-32(27,28)9-2-3-9)18(23-14)31-13-7-12-11(6-10(13)20)29-8-30-12/h6-7,9,22H,1-5,8H2,(H2,21,24,25) |
| InChIKey | RLKAIUWSAOIMGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|