C18H18IN5O4S2 — CID 70855621
N-[2-[8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-6-methylpurin-9-yl]ethyl]cyclopropanesulfonamide (PubChem CID 70855621) has the molecular formula C18H18IN5O4S2 and a molecular weight of 559.41 g/mol. Its IUPAC name is N-[2-[8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-6-methylpurin-9-yl]ethyl]cyclopropanesulfonamide.
| Compound Name | N-[2-[8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-6-methylpurin-9-yl]ethyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 70855621 |
| Molecular Formula | C18H18IN5O4S2 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 558.98 |
| IUPAC Name | N-[2-[8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-6-methylpurin-9-yl]ethyl]cyclopropanesulfonamide |
| SMILES | Cc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C18H18IN5O4S2/c1-10-16-17(21-8-20-10)24(5-4-22-30(25,26)11-2-3-11)18(23-16)29-15-7-14-13(6-12(15)19)27-9-28-14/h6-8,11,22H,2-5,9H2,1H3 |
| InChIKey | MZLUNOZPTXJMEI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|