C21H23F2IN6 — CID 121353220
9-[2-(cyclopropylmethylamino)ethyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine (PubChem CID 121353220) has the molecular formula C21H23F2IN6 and a molecular weight of 524.36 g/mol. Its IUPAC name is 9-[2-(cyclopropylmethylamino)ethyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[2-(cyclopropylmethylamino)ethyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 121353220 |
| Molecular Formula | C21H23F2IN6 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 9-[2-(cyclopropylmethylamino)ethyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)CCC3F)n2CCNCC1CC1 |
| InChI | InChI=1S/C21H23F2IN6/c22-15-4-3-12-8-16(24)13(7-14(12)15)9-17-27-18-19(25)28-21(23)29-20(18)30(17)6-5-26-10-11-1-2-11/h7-8,11,15,26H,1-6,9-10H2,(H2,25,28,29) |
| InChIKey | WMZWCGKUMZMBEC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|