C22H23FN6O2 — CID 121353257
9-[3-(cyclopropylmethylamino)propyl]-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-6-amine (PubChem CID 121353257) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 9-[3-(cyclopropylmethylamino)propyl]-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-6-amine.
| Compound Name | 9-[3-(cyclopropylmethylamino)propyl]-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 121353257 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 9-[3-(cyclopropylmethylamino)propyl]-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-6-amine |
| SMILES | C#Cc1cc2c(cc1Cc1nc3c(N)nc(F)nc3n1CCCNCC1CC1)OCO2 |
| InChI | InChI=1S/C22H23FN6O2/c1-2-14-8-16-17(31-12-30-16)9-15(14)10-18-26-19-20(24)27-22(23)28-21(19)29(18)7-3-6-25-11-13-4-5-13/h1,8-9,13,25H,3-7,10-12H2,(H2,24,27,28) |
| InChIKey | YMJGOUVNVJXCJX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|