C22H24FN7O4S — CID 87274723
3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-9-yl]ethyl]piperidine-1-sulfonamide (PubChem CID 87274723) has the molecular formula C22H24FN7O4S and a molecular weight of 501.54 g/mol. Its IUPAC name is 3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-9-yl]ethyl]piperidine-1-sulfonamide.
| Compound Name | 3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-9-yl]ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 87274723 |
| Molecular Formula | C22H24FN7O4S |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)methyl]-2-fluoropurin-9-yl]ethyl]piperidine-1-sulfonamide |
| SMILES | C#Cc1cc2c(cc1Cc1nc3c(N)nc(F)nc3n1CCC1CCCN(S(N)(=O)=O)C1)OCO2 |
| InChI | InChI=1S/C22H24FN7O4S/c1-2-14-8-16-17(34-12-33-16)9-15(14)10-18-26-19-20(24)27-22(23)28-21(19)30(18)7-5-13-4-3-6-29(11-13)35(25,31)32/h1,8-9,13H,3-7,10-12H2,(H2,24,27,28)(H2,25,31,32) |
| InChIKey | JXNSGFSEVYFUJX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|