C17H17FN6O3 — CID 167039880
N-[2-[6-amino-2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]formamide (PubChem CID 167039880) has the molecular formula C17H17FN6O3 and a molecular weight of 372.36 g/mol. Its IUPAC name is N-[2-[6-amino-2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]formamide.
| Compound Name | N-[2-[6-amino-2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]formamide |
|---|---|
| PubChem CID | 167039880 |
| Molecular Formula | C17H17FN6O3 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-[6-amino-2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl]formamide |
| SMILES | Cc1cc2c(cc1Cc1nc3c(N)nc(F)nc3n1CCNC=O)OCO2 |
| InChI | InChI=1S/C17H17FN6O3/c1-9-4-11-12(27-8-26-11)5-10(9)6-13-21-14-15(19)22-17(18)23-16(14)24(13)3-2-20-7-25/h4-5,7H,2-3,6,8H2,1H3,(H,20,25)(H2,19,22,23) |
| InChIKey | ABAQZSKCMOBBPW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|