C23H30FN7O2 — CID 122667997
8-[[6-(aziridin-1-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]-9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoropurin-6-amine (PubChem CID 122667997) has the molecular formula C23H30FN7O2 and a molecular weight of 455.54 g/mol. Its IUPAC name is 8-[[6-(aziridin-1-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]-9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoropurin-6-amine.
| Compound Name | 8-[[6-(aziridin-1-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]-9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 122667997 |
| Molecular Formula | C23H30FN7O2 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 8-[[6-(aziridin-1-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]-9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoropurin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Cc2cc3c(cc2N2CC2)OCCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C23H30FN7O2/c1-23(2,3)13-26-4-5-31-18(27-19-20(25)28-22(24)29-21(19)31)11-14-10-16-17(33-9-8-32-16)12-15(14)30-6-7-30/h10,12,26H,4-9,11,13H2,1-3H3,(H2,25,28,29) |
| InChIKey | HNUFZVVTIKXARX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|