C23H26FN9O — CID 122667925
9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-2H-benzotriazol-5-yl]methyl]purin-6-amine (PubChem CID 122667925) has the molecular formula C23H26FN9O and a molecular weight of 463.52 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-2H-benzotriazol-5-yl]methyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-2H-benzotriazol-5-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 122667925 |
| Molecular Formula | C23H26FN9O |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[[6-(furan-2-yl)-2H-benzotriazol-5-yl]methyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Cc2cc3n[nH]nc3cc2-c2ccco2)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C23H26FN9O/c1-23(2,3)12-26-6-7-33-18(27-19-20(25)28-22(24)29-21(19)33)10-13-9-15-16(31-32-30-15)11-14(13)17-5-4-8-34-17/h4-5,8-9,11,26H,6-7,10,12H2,1-3H3,(H2,25,28,29)(H,30,31,32) |
| InChIKey | LWEMCJAQJPBGNS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|