C22H28FIN6 — CID 67115848
9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine (PubChem CID 67115848) has the molecular formula C22H28FIN6 and a molecular weight of 522.41 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 67115848 |
| Molecular Formula | C22H28FIN6 |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Cc2cc3c(cc2I)CCC3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C22H28FIN6/c1-22(2,3)12-26-7-8-30-17(27-18-19(25)28-21(23)29-20(18)30)11-15-9-13-5-4-6-14(13)10-16(15)24/h9-10,26H,4-8,11-12H2,1-3H3,(H2,25,28,29) |
| InChIKey | CNDXEQUHBLSOJE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|