C17H18FIN6O2S — CID 70855683
2-[6-amino-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-9-yl]ethanesulfonamide (PubChem CID 70855683) has the molecular formula C17H18FIN6O2S and a molecular weight of 516.34 g/mol. Its IUPAC name is 2-[6-amino-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-9-yl]ethanesulfonamide.
| Compound Name | 2-[6-amino-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-9-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 70855683 |
| Molecular Formula | C17H18FIN6O2S |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2-[6-amino-2-fluoro-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-9-yl]ethanesulfonamide |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)CCC3)n2CCS(N)(=O)=O |
| InChI | InChI=1S/C17H18FIN6O2S/c18-17-23-15(20)14-16(24-17)25(4-5-28(21,26)27)13(22-14)8-11-6-9-2-1-3-10(9)7-12(11)19/h6-7H,1-5,8H2,(H2,20,23,24)(H2,21,26,27) |
| InChIKey | WWQIVYDYDDPBDZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|