C18H16FIN6O2 — CID 70855493
3-[6-amino-2-fluoro-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)methyl]purin-9-yl]propanamide (PubChem CID 70855493) has the molecular formula C18H16FIN6O2 and a molecular weight of 494.27 g/mol. Its IUPAC name is 3-[6-amino-2-fluoro-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)methyl]purin-9-yl]propanamide.
| Compound Name | 3-[6-amino-2-fluoro-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)methyl]purin-9-yl]propanamide |
|---|---|
| PubChem CID | 70855493 |
| Molecular Formula | C18H16FIN6O2 |
| Molecular Weight | 494.27 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 3-[6-amino-2-fluoro-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)methyl]purin-9-yl]propanamide |
| SMILES | NC(=O)CCn1c(Cc2cc3c(cc2I)CCC3=O)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C18H16FIN6O2/c19-18-24-16(22)15-17(25-18)26(4-3-13(21)28)14(23-15)7-9-5-10-8(6-11(9)20)1-2-12(10)27/h5-6H,1-4,7H2,(H2,21,28)(H2,22,24,25) |
| InChIKey | WUTDHEDLVDWLBU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|