C22H31FN6O2 — CID 145160011
ethane;2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 145160011) has the molecular formula C22H31FN6O2 and a molecular weight of 430.53 g/mol. Its IUPAC name is ethane;2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | ethane;2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 145160011 |
| Molecular Formula | C22H31FN6O2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethane;2-fluoro-8-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | CC.Cc1cc2c(cc1Cc1nc3c(N)nc(F)nc3n1CCCNC(C)C)OCO2 |
| InChI | InChI=1S/C20H25FN6O2.C2H6/c1-11(2)23-5-4-6-27-16(24-17-18(22)25-20(21)26-19(17)27)9-13-8-15-14(7-12(13)3)28-10-29-15;1-2/h7-8,11,23H,4-6,9-10H2,1-3H3,(H2,22,25,26);1-2H3 |
| InChIKey | XPHCCENYLZQJKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|