C13H19FN6O2S — CID 142789940
2-fluoro-9-[2-(1-methylsulfonylpiperidin-3-yl)ethyl]purin-6-amine (PubChem CID 142789940) has the molecular formula C13H19FN6O2S and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-fluoro-9-[2-(1-methylsulfonylpiperidin-3-yl)ethyl]purin-6-amine.
| Compound Name | 2-fluoro-9-[2-(1-methylsulfonylpiperidin-3-yl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 142789940 |
| Molecular Formula | C13H19FN6O2S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-fluoro-9-[2-(1-methylsulfonylpiperidin-3-yl)ethyl]purin-6-amine |
| SMILES | CS(=O)(=O)N1CCCC(CCn2cnc3c(N)nc(F)nc32)C1 |
| InChI | InChI=1S/C13H19FN6O2S/c1-23(21,22)20-5-2-3-9(7-20)4-6-19-8-16-10-11(15)17-13(14)18-12(10)19/h8-9H,2-7H2,1H3,(H2,15,17,18) |
| InChIKey | LHIYRMXMWOCRDM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |