C23H25FN6O — CID 87274695
6-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)methyl]-2-fluoropurin-9-yl]hexanamide (PubChem CID 87274695) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 6-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)methyl]-2-fluoropurin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)methyl]-2-fluoropurin-9-yl]hexanamide |
|---|---|
| PubChem CID | 87274695 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 6-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)methyl]-2-fluoropurin-9-yl]hexanamide |
| SMILES | C#Cc1cc2c(cc1Cc1nc3c(N)nc(F)nc3n1CCCCCC(N)=O)CCC2 |
| InChI | InChI=1S/C23H25FN6O/c1-2-14-11-15-7-6-8-16(15)12-17(14)13-19-27-20-21(26)28-23(24)29-22(20)30(19)10-5-3-4-9-18(25)31/h1,11-12H,3-10,13H2,(H2,25,31)(H2,26,28,29) |
| InChIKey | NOAZXZCSSBYIFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|