C19H19N7O3 — CID 121357822
methyl 8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate (PubChem CID 121357822) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is methyl 8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate.
| Compound Name | methyl 8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 121357822 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl 8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)N(C(=O)Nc1n[nH]c3nc(C)ccc13)C1CCN2C1 |
| InChI | InChI=1S/C19H19N7O3/c1-10-3-4-12-15(20-10)23-24-16(12)22-19(28)26-11-7-8-25(9-11)14-6-5-13(18(27)29-2)21-17(14)26/h3-6,11H,7-9H2,1-2H3,(H2,20,22,23,24,28) |
| InChIKey | SLNGFRADQXAZRN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |