C17H17N5O4 — CID 145084377
8-[(1-methyl-4-oxo-3-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid (PubChem CID 145084377) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 8-[(1-methyl-4-oxo-3-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid.
| Compound Name | 8-[(1-methyl-4-oxo-3-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 145084377 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 8-[(1-methyl-4-oxo-3-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
| SMILES | Cn1ccc(=O)c(NC(=O)N2c3nc(C(=O)O)ccc3N3CCC2C3)c1 |
| InChI | InChI=1S/C17H17N5O4/c1-20-6-5-14(23)12(9-20)19-17(26)22-10-4-7-21(8-10)13-3-2-11(16(24)25)18-15(13)22/h2-3,5-6,9-10H,4,7-8H2,1H3,(H,19,26)(H,24,25) |
| InChIKey | VKYRKFUPEHTSLG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |