C13H9ClN2OS — CID 121360083
5-(3-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 121360083) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 121360083 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 5-(3-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc[nH]c(=O)c2c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClN2OS/c1-7-10(8-3-2-4-9(14)5-8)11-12(17)15-6-16-13(11)18-7/h2-6H,1H3,(H,15,16,17) |
| InChIKey | FWCYLEVSJMYMMT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |