C13H6N2O2S — CID 125490792
8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene-3,10-dione (PubChem CID 125490792) has the molecular formula C13H6N2O2S and a molecular weight of 254.27 g/mol. Its IUPAC name is 8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene-3,10-dione.
| Compound Name | 8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene-3,10-dione |
|---|---|
| PubChem CID | 125490792 |
| Molecular Formula | C13H6N2O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene-3,10-dione |
| SMILES | O=C1c2ccccc2-c2c1sc1nc[nH]c(=O)c21 |
| InChI | InChI=1S/C13H6N2O2S/c16-10-7-4-2-1-3-6(7)8-9-12(17)14-5-15-13(9)18-11(8)10/h1-5H,(H,14,15,17) |
| InChIKey | JUIHVCGKXNPROM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |