C22H29N3O3 — CID 121363360
tert-butyl-[(2R)-4-methyl-1-oxo-1-(4-pyridin-4-ylanilino)pentan-2-yl]carbamic acid (PubChem CID 121363360) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl-[(2R)-4-methyl-1-oxo-1-(4-pyridin-4-ylanilino)pentan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-4-methyl-1-oxo-1-(4-pyridin-4-ylanilino)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 121363360 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl-[(2R)-4-methyl-1-oxo-1-(4-pyridin-4-ylanilino)pentan-2-yl]carbamic acid |
| SMILES | CC(C)C[C@H](C(=O)Nc1ccc(-c2ccncc2)cc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C22H29N3O3/c1-15(2)14-19(25(21(27)28)22(3,4)5)20(26)24-18-8-6-16(7-9-18)17-10-12-23-13-11-17/h6-13,15,19H,14H2,1-5H3,(H,24,26)(H,27,28)/t19-/m1/s1 |
| InChIKey | OIINPTLXIRDBJX-LJQANCHMSA-N |
| XLogP | 4.88 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |