C36H59N2O+ — CID 121365792
benzyl-[3-[[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]-dimethylazanium (PubChem CID 121365792) has the molecular formula C36H59N2O+ and a molecular weight of 535.88 g/mol. Its IUPAC name is benzyl-[3-[[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]-dimethylazanium.
| Compound Name | benzyl-[3-[[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 121365792 |
| Molecular Formula | C36H59N2O+ |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.46 |
| IUPAC Name | benzyl-[3-[[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]-dimethylazanium |
| SMILES | C[C@H](CCC(=O)NCCC[N+](C)(C)Cc1ccccc1)[C@H]1CCC2C3CCC4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H58N2O/c1-27(15-20-34(39)37-24-11-25-38(4,5)26-28-12-7-6-8-13-28)31-18-19-32-30-17-16-29-14-9-10-22-35(29,2)33(30)21-23-36(31,32)3/h6-8,12-13,27,29-33H,9-11,14-26H2,1-5H3/p+1/t27-,29?,30?,31-,32?,33?,35+,36-/m1/s1 |
| InChIKey | QPRWMXPGKAQOLS-WYKOVRGBSA-O |
| XLogP | 8.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|