About N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine
N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine (PubChem CID 121367696) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine.
Analyze N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine (CID 121367696) is N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine is Cc1nnn(CCNC(C)C)c1C.
What is the InChIKey of N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine?
The InChIKey is SSBVGHTXAAYWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-7(2)10-5-6-13-9(4)8(3)11-12-13/h7,10H,5-6H2,1-4H3.
What are the key properties of N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine?
N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine has a molecular weight of 182.27 g/mol, XLogP of 0.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,5-dimethyltriazol-1-yl)ethyl]propan-2-amine is sourced from PubChem (CID 121367696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).