C9H18N4 — CID 165452036
4,5-dimethyl-N-(3-methylbutyl)triazol-1-amine (PubChem CID 165452036) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 4,5-dimethyl-N-(3-methylbutyl)triazol-1-amine.
| Compound Name | 4,5-dimethyl-N-(3-methylbutyl)triazol-1-amine |
|---|---|
| PubChem CID | 165452036 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 4,5-dimethyl-N-(3-methylbutyl)triazol-1-amine |
| SMILES | Cc1nnn(NCCC(C)C)c1C |
| InChI | InChI=1S/C9H18N4/c1-7(2)5-6-10-13-9(4)8(3)11-12-13/h7,10H,5-6H2,1-4H3 |
| InChIKey | UJGGAOMNBCGVTE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |