C14H31N3 — CID 177341764
1,4-dimethyl-5-(3-methylpentyl)triazole;ethane (PubChem CID 177341764) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is 1,4-dimethyl-5-(3-methylpentyl)triazole;ethane.
| Compound Name | 1,4-dimethyl-5-(3-methylpentyl)triazole;ethane |
|---|---|
| PubChem CID | 177341764 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | 1,4-dimethyl-5-(3-methylpentyl)triazole;ethane |
| SMILES | CC.CC.CCC(C)CCc1c(C)nnn1C |
| InChI | InChI=1S/C10H19N3.2C2H6/c1-5-8(2)6-7-10-9(3)11-12-13(10)4;2*1-2/h8H,5-7H2,1-4H3;2*1-2H3 |
| InChIKey | BFYGLDKONXABLU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |