C15H24N2O2 — CID 121369019
octan-2-yl (2E,4E)-2-cyano-5-(methylamino)penta-2,4-dienoate (PubChem CID 121369019) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is octan-2-yl (2E,4E)-2-cyano-5-(methylamino)penta-2,4-dienoate.
| Compound Name | octan-2-yl (2E,4E)-2-cyano-5-(methylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 121369019 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | octan-2-yl (2E,4E)-2-cyano-5-(methylamino)penta-2,4-dienoate |
| SMILES | CCCCCCC(C)OC(=O)/C(C#N)=C/C=C/NC |
| InChI | InChI=1S/C15H24N2O2/c1-4-5-6-7-9-13(2)19-15(18)14(12-16)10-8-11-17-3/h8,10-11,13,17H,4-7,9H2,1-3H3/b11-8+,14-10+ |
| InChIKey | MUUNCZORMBJLIJ-CTQAOBCWSA-N |
| XLogP | 3.07 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|