C14H28O2 — CID 121371615
3-(1-methoxy-2,2-dimethylpropoxy)-2,4,4-trimethylpent-1-ene (PubChem CID 121371615) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-(1-methoxy-2,2-dimethylpropoxy)-2,4,4-trimethylpent-1-ene.
| Compound Name | 3-(1-methoxy-2,2-dimethylpropoxy)-2,4,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 121371615 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3-(1-methoxy-2,2-dimethylpropoxy)-2,4,4-trimethylpent-1-ene |
| SMILES | C=C(C)C(OC(OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-10(2)11(13(3,4)5)16-12(15-9)14(6,7)8/h11-12H,1H2,2-9H3 |
| InChIKey | RZXOGTIDPWVDME-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|