C14H30O2 — CID 121371921
3-(1-methoxy-2,2-dimethylpropoxy)-2,2-dimethylhexane (PubChem CID 121371921) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3-(1-methoxy-2,2-dimethylpropoxy)-2,2-dimethylhexane.
| Compound Name | 3-(1-methoxy-2,2-dimethylpropoxy)-2,2-dimethylhexane |
|---|---|
| PubChem CID | 121371921 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 3-(1-methoxy-2,2-dimethylpropoxy)-2,2-dimethylhexane |
| SMILES | CCCC(OC(OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2/c1-9-10-11(13(2,3)4)16-12(15-8)14(5,6)7/h11-12H,9-10H2,1-8H3 |
| InChIKey | WOXJVDRUJPTRBS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|