C14H12F14O — CID 139751233
4,5,5,5-tetrafluoro-2-methyl-3-[4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-1-en-3-yl]oxy-4-(trifluoromethyl)pent-1-ene (PubChem CID 139751233) has the molecular formula C14H12F14O and a molecular weight of 462.22 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-2-methyl-3-[4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-1-en-3-yl]oxy-4-(trifluoromethyl)pent-1-ene.
| Compound Name | 4,5,5,5-tetrafluoro-2-methyl-3-[4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-1-en-3-yl]oxy-4-(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 139751233 |
| Molecular Formula | C14H12F14O |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4,5,5,5-tetrafluoro-2-methyl-3-[4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-1-en-3-yl]oxy-4-(trifluoromethyl)pent-1-ene |
| SMILES | C=C(C)C(OC(C(=C)C)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H12F14O/c1-5(2)7(9(15,11(17,18)19)12(20,21)22)29-8(6(3)4)10(16,13(23,24)25)14(26,27)28/h7-8H,1,3H2,2,4H3 |
| InChIKey | QMMFKCQRANZAAC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|