C6H8F5NO — CID 89359164
4,4,5,5,5-pentafluoro-3-methoxypent-1-en-2-amine (PubChem CID 89359164) has the molecular formula C6H8F5NO and a molecular weight of 205.13 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-methoxypent-1-en-2-amine.
| Compound Name | 4,4,5,5,5-pentafluoro-3-methoxypent-1-en-2-amine |
|---|---|
| PubChem CID | 89359164 |
| Molecular Formula | C6H8F5NO |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-methoxypent-1-en-2-amine |
| SMILES | C=C(N)C(OC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO/c1-3(12)4(13-2)5(7,8)6(9,10)11/h4H,1,12H2,2H3 |
| InChIKey | DRLGNUGJSGKCPT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|