C21H24F2O3S — CID 121383050
5-[2-(benzenesulfonyl)ethyl]-7-(2,5-difluorophenyl)heptan-2-one (PubChem CID 121383050) has the molecular formula C21H24F2O3S and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-[2-(benzenesulfonyl)ethyl]-7-(2,5-difluorophenyl)heptan-2-one.
| Compound Name | 5-[2-(benzenesulfonyl)ethyl]-7-(2,5-difluorophenyl)heptan-2-one |
|---|---|
| PubChem CID | 121383050 |
| Molecular Formula | C21H24F2O3S |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-[2-(benzenesulfonyl)ethyl]-7-(2,5-difluorophenyl)heptan-2-one |
| SMILES | CC(=O)CCC(CCc1cc(F)ccc1F)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24F2O3S/c1-16(24)7-8-17(9-10-18-15-19(22)11-12-21(18)23)13-14-27(25,26)20-5-3-2-4-6-20/h2-6,11-12,15,17H,7-10,13-14H2,1H3 |
| InChIKey | BKNAWENCWITPRC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |