C29H54BrN5O8 — CID 121383525
1-[bis[3-(1-morpholin-4-ylpropan-2-yloxycarbonylamino)propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate (PubChem CID 121383525) has the molecular formula C29H54BrN5O8 and a molecular weight of 680.68 g/mol. Its IUPAC name is 1-[bis[3-(1-morpholin-4-ylpropan-2-yloxycarbonylamino)propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate.
| Compound Name | 1-[bis[3-(1-morpholin-4-ylpropan-2-yloxycarbonylamino)propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 121383525 |
| Molecular Formula | C29H54BrN5O8 |
| Molecular Weight | 680.68 g/mol |
| Exact Mass | 679.32 |
| IUPAC Name | 1-[bis[3-(1-morpholin-4-ylpropan-2-yloxycarbonylamino)propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
| SMILES | CC(CN1CCOCC1)OC(=O)NCCCN(CCCNC(=O)OC(C)CN1CCOCC1)CC(C)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C29H54BrN5O8/c1-23(41-26(36)29(4,5)30)20-33(10-6-8-31-27(37)42-24(2)21-34-12-16-39-17-13-34)11-7-9-32-28(38)43-25(3)22-35-14-18-40-19-15-35/h23-25H,6-22H2,1-5H3,(H,31,37)(H,32,38) |
| InChIKey | VUPLQAXWESIOJQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|