C25H50BrN5O6 — CID 121383702
1-[bis[3-[1-(dimethylamino)propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate (PubChem CID 121383702) has the molecular formula C25H50BrN5O6 and a molecular weight of 596.61 g/mol. Its IUPAC name is 1-[bis[3-[1-(dimethylamino)propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate.
| Compound Name | 1-[bis[3-[1-(dimethylamino)propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 121383702 |
| Molecular Formula | C25H50BrN5O6 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 1-[bis[3-[1-(dimethylamino)propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
| SMILES | CC(CN(C)C)OC(=O)NCCCN(CCCNC(=O)OC(C)CN(C)C)CC(C)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C25H50BrN5O6/c1-19(16-29(6)7)36-23(33)27-12-10-14-31(18-21(3)35-22(32)25(4,5)26)15-11-13-28-24(34)37-20(2)17-30(8)9/h19-21H,10-18H2,1-9H3,(H,27,33)(H,28,34) |
| InChIKey | FXMZXLCGOFBQPV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|