C12H18S2 — CID 121384557
7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradecane (PubChem CID 121384557) has the molecular formula C12H18S2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradecane.
| Compound Name | 7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradecane |
|---|---|
| PubChem CID | 121384557 |
| Molecular Formula | C12H18S2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradecane |
| SMILES | C1CC2SC3C4CCCC4SC3C2C1 |
| InChI | InChI=1S/C12H18S2/c1-3-7-9(5-1)13-12-8-4-2-6-10(8)14-11(7)12/h7-12H,1-6H2 |
| InChIKey | MFJPGNFCPJAWTQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |