About 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane
3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane (PubChem CID 121384558) has the molecular formula C14H20S3
and a molecular weight of 284.52 g/mol. Its IUPAC name is 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane.
Analyze 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane?
The IUPAC name of 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane (CID 121384558) is 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane.
What is the SMILES notation for 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane?
The canonical SMILES for 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane is C1CC2SC3C(SC4C5CCCC5SC43)C2C1.
What is the InChIKey of 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane?
The InChIKey is BSKONXVGWDWJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S3/c1-3-7-9(5-1)15-13-11(7)17-12-8-4-2-6-10(8)16-14(12)13/h7-14H,1-6H2.
What are the key properties of 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane?
3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane has a molecular weight of 284.52 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,10,17-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane is sourced from PubChem (CID 121384558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).