C10H16S — CID 131851241
(1S,2S,6S,8S)-7-thiatricyclo[6.3.0.02,6]undecane (PubChem CID 131851241) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (1S,2S,6S,8S)-7-thiatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1S,2S,6S,8S)-7-thiatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 131851241 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (1S,2S,6S,8S)-7-thiatricyclo[6.3.0.02,6]undecane |
| SMILES | C1C[C@H]2[C@@H]3CCC[C@@H]3S[C@H]2C1 |
| InChI | InChI=1S/C10H16S/c1-3-7-8-4-2-6-10(8)11-9(7)5-1/h7-10H,1-6H2/t7-,8-,9-,10-/m0/s1 |
| InChIKey | LLVVVUMYGPJNBH-XKNYDFJKSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |