C10H18N2O3 — CID 121391959
N-[(2S,3R)-2-acetamido-3-methoxypent-4-enyl]acetamide (PubChem CID 121391959) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-[(2S,3R)-2-acetamido-3-methoxypent-4-enyl]acetamide.
| Compound Name | N-[(2S,3R)-2-acetamido-3-methoxypent-4-enyl]acetamide |
|---|---|
| PubChem CID | 121391959 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-[(2S,3R)-2-acetamido-3-methoxypent-4-enyl]acetamide |
| SMILES | C=C[C@@H](OC)[C@H](CNC(C)=O)NC(C)=O |
| InChI | InChI=1S/C10H18N2O3/c1-5-10(15-4)9(12-8(3)14)6-11-7(2)13/h5,9-10H,1,6H2,2-4H3,(H,11,13)(H,12,14)/t9-,10+/m0/s1 |
| InChIKey | AJYXGAGPIAPQOX-VHSXEESVSA-N |
| XLogP | -0.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|