C28H32N4O4 — CID 121394521
2-(diethylamino)-N-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-1-yl]acetamide (PubChem CID 121394521) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-(diethylamino)-N-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-1-yl]acetamide.
| Compound Name | 2-(diethylamino)-N-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-1-yl]acetamide |
|---|---|
| PubChem CID | 121394521 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-(diethylamino)-N-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-1-yl]acetamide |
| SMILES | CCN(CC)CC(=O)Nc1cccc2c1Cc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1O2 |
| InChI | InChI=1S/C28H32N4O4/c1-3-31(4-2)18-27(34)29-23-9-6-10-25-22(23)15-19-7-5-8-21(28(19)36-25)24-16-20(17-26(33)30-24)32-11-13-35-14-12-32/h5-10,16-17H,3-4,11-15,18H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | WBQMDIVQNARNGQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |