C27H25N5O2S2 — CID 121394825
4-morpholin-4-yl-6-[7-(1-pyrimidin-2-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one (PubChem CID 121394825) has the molecular formula C27H25N5O2S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(1-pyrimidin-2-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(1-pyrimidin-2-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394825 |
| Molecular Formula | C27H25N5O2S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(1-pyrimidin-2-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one |
| SMILES | CC(Nc1ccc2c(c1)Sc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1S2)c1ncccn1 |
| InChI | InChI=1S/C27H25N5O2S2/c1-17(27-28-8-3-9-29-27)30-18-6-7-22-24(14-18)35-23-5-2-4-20(26(23)36-22)21-15-19(16-25(33)31-21)32-10-12-34-13-11-32/h2-9,14-17,30H,10-13H2,1H3,(H,31,33) |
| InChIKey | HCNKKFWIUKFONV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |