C24H23Cl2N3O2S2 — CID 121394567
6-[7-(1,3-dichloropropan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 121394567) has the molecular formula C24H23Cl2N3O2S2 and a molecular weight of 520.51 g/mol. Its IUPAC name is 6-[7-(1,3-dichloropropan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[7-(1,3-dichloropropan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394567 |
| Molecular Formula | C24H23Cl2N3O2S2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 6-[7-(1,3-dichloropropan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Sc2ccc(NC(CCl)CCl)cc2S3)[nH]1 |
| InChI | InChI=1S/C24H23Cl2N3O2S2/c25-13-16(14-26)27-15-4-5-20-22(10-15)32-21-3-1-2-18(24(21)33-20)19-11-17(12-23(30)28-19)29-6-8-31-9-7-29/h1-5,10-12,16,27H,6-9,13-14H2,(H,28,30) |
| InChIKey | CGRHOLUQKNBKDO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|