C27H30N4O3S2 — CID 121394899
4-morpholin-4-yl-6-[7-(2-morpholin-4-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one (PubChem CID 121394899) has the molecular formula C27H30N4O3S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(2-morpholin-4-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(2-morpholin-4-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394899 |
| Molecular Formula | C27H30N4O3S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(2-morpholin-4-ylethylamino)thianthren-1-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Sc2ccc(NCCN4CCOCC4)cc2S3)[nH]1 |
| InChI | InChI=1S/C27H30N4O3S2/c32-26-18-20(31-10-14-34-15-11-31)17-22(29-26)21-2-1-3-24-27(21)36-23-5-4-19(16-25(23)35-24)28-6-7-30-8-12-33-13-9-30/h1-5,16-18,28H,6-15H2,(H,29,32) |
| InChIKey | SQXAMUYIRNKBRK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |