C27H30N4O2S2 — CID 154407591
6-[7-[(1-methylpiperidin-4-yl)amino]thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 154407591) has the molecular formula C27H30N4O2S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 6-[7-[(1-methylpiperidin-4-yl)amino]thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[7-[(1-methylpiperidin-4-yl)amino]thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154407591 |
| Molecular Formula | C27H30N4O2S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 6-[7-[(1-methylpiperidin-4-yl)amino]thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | CN1CCC(Nc2ccc3c(c2)Sc2cccc(-c4cc(N5CCOCC5)cc(=O)[nH]4)c2S3)CC1 |
| InChI | InChI=1S/C27H30N4O2S2/c1-30-9-7-18(8-10-30)28-19-5-6-23-25(15-19)34-24-4-2-3-21(27(24)35-23)22-16-20(17-26(32)29-22)31-11-13-33-14-12-31/h2-6,15-18,28H,7-14H2,1H3,(H,29,32) |
| InChIKey | LSIDPYUULYQHSF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |