C29H34N4O3S2 — CID 121394592
4-morpholin-4-yl-6-[7-(4-morpholin-4-ylbutan-2-ylamino)thianthren-1-yl]-1H-pyridin-2-one (PubChem CID 121394592) has the molecular formula C29H34N4O3S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(4-morpholin-4-ylbutan-2-ylamino)thianthren-1-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(4-morpholin-4-ylbutan-2-ylamino)thianthren-1-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394592 |
| Molecular Formula | C29H34N4O3S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(4-morpholin-4-ylbutan-2-ylamino)thianthren-1-yl]-1H-pyridin-2-one |
| SMILES | CC(CCN1CCOCC1)Nc1ccc2c(c1)Sc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1S2 |
| InChI | InChI=1S/C29H34N4O3S2/c1-20(7-8-32-9-13-35-14-10-32)30-21-5-6-25-27(17-21)37-26-4-2-3-23(29(26)38-25)24-18-22(19-28(34)31-24)33-11-15-36-16-12-33/h2-6,17-20,30H,7-16H2,1H3,(H,31,34) |
| InChIKey | BIOGUOAIRIBYRI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |