C25H27N3O3S2 — CID 155132231
6-[7-(1-hydroxybutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 155132231) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 6-[7-(1-hydroxybutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[7-(1-hydroxybutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155132231 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 6-[7-(1-hydroxybutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | CCC(CO)Nc1ccc2c(c1)Sc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1S2 |
| InChI | InChI=1S/C25H27N3O3S2/c1-2-16(15-29)26-17-6-7-21-23(12-17)32-22-5-3-4-19(25(22)33-21)20-13-18(14-24(30)27-20)28-8-10-31-11-9-28/h3-7,12-14,16,26,29H,2,8-11,15H2,1H3,(H,27,30) |
| InChIKey | HMEGQBQVIZSDOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |