C27H24N4O2S2 — CID 121393836
6-[7-(2-aminoanilino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 121393836) has the molecular formula C27H24N4O2S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 6-[7-(2-aminoanilino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[7-(2-aminoanilino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121393836 |
| Molecular Formula | C27H24N4O2S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 6-[7-(2-aminoanilino)thianthren-1-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | Nc1ccccc1Nc1ccc2c(c1)Sc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1S2 |
| InChI | InChI=1S/C27H24N4O2S2/c28-20-5-1-2-6-21(20)29-17-8-9-23-25(14-17)34-24-7-3-4-19(27(24)35-23)22-15-18(16-26(32)30-22)31-10-12-33-13-11-31/h1-9,14-16,29H,10-13,28H2,(H,30,32) |
| InChIKey | IUGLCIUSJNKBPW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|